C18H27FN2O3 — CID 18886235
2-(2-ethylhexylamino)-4-(3-fluoroanilino)-4-oxobutanoic acid (PubChem CID 18886235) has the molecular formula C18H27FN2O3 and a molecular weight of 338.42 g/mol. Its IUPAC name is 2-(2-ethylhexylamino)-4-(3-fluoroanilino)-4-oxobutanoic acid.
| Compound Name | 2-(2-ethylhexylamino)-4-(3-fluoroanilino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18886235 |
| Molecular Formula | C18H27FN2O3 |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 2-(2-ethylhexylamino)-4-(3-fluoroanilino)-4-oxobutanoic acid |
| SMILES | CCCCC(CC)CNC(CC(=O)Nc1cccc(F)c1)C(=O)O |
| InChI | InChI=1S/C18H27FN2O3/c1-3-5-7-13(4-2)12-20-16(18(23)24)11-17(22)21-15-9-6-8-14(19)10-15/h6,8-10,13,16,20H,3-5,7,11-12H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | FOGXEWLLJOWYRU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |