C18H26F2N2O3 — CID 7592581
(2R)-4-(2,4-difluoroanilino)-2-[[(2R)-2-ethylhexyl]amino]-4-oxobutanoic acid (PubChem CID 7592581) has the molecular formula C18H26F2N2O3 and a molecular weight of 356.41 g/mol. Its IUPAC name is (2R)-4-(2,4-difluoroanilino)-2-[[(2R)-2-ethylhexyl]amino]-4-oxobutanoic acid.
| Compound Name | (2R)-4-(2,4-difluoroanilino)-2-[[(2R)-2-ethylhexyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 7592581 |
| Molecular Formula | C18H26F2N2O3 |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | (2R)-4-(2,4-difluoroanilino)-2-[[(2R)-2-ethylhexyl]amino]-4-oxobutanoic acid |
| SMILES | CCCC[C@@H](CC)CN[C@H](CC(=O)Nc1ccc(F)cc1F)C(=O)O |
| InChI | InChI=1S/C18H26F2N2O3/c1-3-5-6-12(4-2)11-21-16(18(24)25)10-17(23)22-15-8-7-13(19)9-14(15)20/h7-9,12,16,21H,3-6,10-11H2,1-2H3,(H,22,23)(H,24,25)/t12-,16-/m1/s1 |
| InChIKey | UAMVQSCENRIJKN-MLGOLLRUSA-N |
| XLogP | 3.55 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |