C19H29N3O5 — CID 7592033
(2S)-2-[[(2S)-2-ethylhexyl]amino]-4-(2-methyl-5-nitroanilino)-4-oxobutanoic acid (PubChem CID 7592033) has the molecular formula C19H29N3O5 and a molecular weight of 379.46 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-ethylhexyl]amino]-4-(2-methyl-5-nitroanilino)-4-oxobutanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-ethylhexyl]amino]-4-(2-methyl-5-nitroanilino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 7592033 |
| Molecular Formula | C19H29N3O5 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | (2S)-2-[[(2S)-2-ethylhexyl]amino]-4-(2-methyl-5-nitroanilino)-4-oxobutanoic acid |
| SMILES | CCCC[C@H](CC)CN[C@@H](CC(=O)Nc1cc([N+](=O)[O-])ccc1C)C(=O)O |
| InChI | InChI=1S/C19H29N3O5/c1-4-6-7-14(5-2)12-20-17(19(24)25)11-18(23)21-16-10-15(22(26)27)9-8-13(16)3/h8-10,14,17,20H,4-7,11-12H2,1-3H3,(H,21,23)(H,24,25)/t14-,17-/m0/s1 |
| InChIKey | LZVKCQWEOXLAKJ-YOEHRIQHSA-N |
| XLogP | 3.49 |
| TPSA | 121.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|