C15H21N3O6 — CID 40500047
(2R)-2-(3-methoxypropylamino)-4-(2-methyl-5-nitroanilino)-4-oxobutanoic acid (PubChem CID 40500047) has the molecular formula C15H21N3O6 and a molecular weight of 339.35 g/mol. Its IUPAC name is (2R)-2-(3-methoxypropylamino)-4-(2-methyl-5-nitroanilino)-4-oxobutanoic acid.
| Compound Name | (2R)-2-(3-methoxypropylamino)-4-(2-methyl-5-nitroanilino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 40500047 |
| Molecular Formula | C15H21N3O6 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | (2R)-2-(3-methoxypropylamino)-4-(2-methyl-5-nitroanilino)-4-oxobutanoic acid |
| SMILES | COCCCN[C@H](CC(=O)Nc1cc([N+](=O)[O-])ccc1C)C(=O)O |
| InChI | InChI=1S/C15H21N3O6/c1-10-4-5-11(18(22)23)8-12(10)17-14(19)9-13(15(20)21)16-6-3-7-24-2/h4-5,8,13,16H,3,6-7,9H2,1-2H3,(H,17,19)(H,20,21)/t13-/m1/s1 |
| InChIKey | VRYXKCAVMYYZKL-CYBMUJFWSA-N |
| XLogP | 1.31 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|