C21H25N3O8 — CID 18858514
2-[2-(3,4-dimethoxyphenyl)ethylamino]-4-(2-methoxy-5-nitroanilino)-4-oxobutanoic acid (PubChem CID 18858514) has the molecular formula C21H25N3O8 and a molecular weight of 447.44 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)ethylamino]-4-(2-methoxy-5-nitroanilino)-4-oxobutanoic acid.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)ethylamino]-4-(2-methoxy-5-nitroanilino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18858514 |
| Molecular Formula | C21H25N3O8 |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)ethylamino]-4-(2-methoxy-5-nitroanilino)-4-oxobutanoic acid |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)CC(NCCc1ccc(OC)c(OC)c1)C(=O)O |
| InChI | InChI=1S/C21H25N3O8/c1-30-17-7-5-14(24(28)29)11-15(17)23-20(25)12-16(21(26)27)22-9-8-13-4-6-18(31-2)19(10-13)32-3/h4-7,10-11,16,22H,8-9,12H2,1-3H3,(H,23,25)(H,26,27) |
| InChIKey | WZNOMIWTQKFVMM-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 149.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|