C15H21N3O8 — CID 18858530
2-[2-(2-hydroxyethoxy)ethylamino]-4-(2-methoxy-5-nitroanilino)-4-oxobutanoic acid (PubChem CID 18858530) has the molecular formula C15H21N3O8 and a molecular weight of 371.35 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethoxy)ethylamino]-4-(2-methoxy-5-nitroanilino)-4-oxobutanoic acid.
| Compound Name | 2-[2-(2-hydroxyethoxy)ethylamino]-4-(2-methoxy-5-nitroanilino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18858530 |
| Molecular Formula | C15H21N3O8 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 2-[2-(2-hydroxyethoxy)ethylamino]-4-(2-methoxy-5-nitroanilino)-4-oxobutanoic acid |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)CC(NCCOCCO)C(=O)O |
| InChI | InChI=1S/C15H21N3O8/c1-25-13-3-2-10(18(23)24)8-11(13)17-14(20)9-12(15(21)22)16-4-6-26-7-5-19/h2-3,8,12,16,19H,4-7,9H2,1H3,(H,17,20)(H,21,22) |
| InChIKey | QOSYHJWMVUEAMG-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 160.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|