C14H18Cl2N2O5 — CID 3378943
4-(2,5-dichloroanilino)-2-[2-(2-hydroxyethoxy)ethylamino]-4-oxobutanoic acid (PubChem CID 3378943) has the molecular formula C14H18Cl2N2O5 and a molecular weight of 365.21 g/mol. Its IUPAC name is 4-(2,5-dichloroanilino)-2-[2-(2-hydroxyethoxy)ethylamino]-4-oxobutanoic acid.
| Compound Name | 4-(2,5-dichloroanilino)-2-[2-(2-hydroxyethoxy)ethylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 3378943 |
| Molecular Formula | C14H18Cl2N2O5 |
| Molecular Weight | 365.21 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | 4-(2,5-dichloroanilino)-2-[2-(2-hydroxyethoxy)ethylamino]-4-oxobutanoic acid |
| SMILES | O=C(CC(NCCOCCO)C(=O)O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H18Cl2N2O5/c15-9-1-2-10(16)11(7-9)18-13(20)8-12(14(21)22)17-3-5-23-6-4-19/h1-2,7,12,17,19H,3-6,8H2,(H,18,20)(H,21,22) |
| InChIKey | OZUIGKUJDHQFKV-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.21 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|