C12H14Cl2N2O4 — CID 18581192
4-(3,5-dichloroanilino)-2-(2-hydroxyethylamino)-4-oxobutanoic acid (PubChem CID 18581192) has the molecular formula C12H14Cl2N2O4 and a molecular weight of 321.16 g/mol. Its IUPAC name is 4-(3,5-dichloroanilino)-2-(2-hydroxyethylamino)-4-oxobutanoic acid.
| Compound Name | 4-(3,5-dichloroanilino)-2-(2-hydroxyethylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18581192 |
| Molecular Formula | C12H14Cl2N2O4 |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 4-(3,5-dichloroanilino)-2-(2-hydroxyethylamino)-4-oxobutanoic acid |
| SMILES | O=C(CC(NCCO)C(=O)O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C12H14Cl2N2O4/c13-7-3-8(14)5-9(4-7)16-11(18)6-10(12(19)20)15-1-2-17/h3-5,10,15,17H,1-2,6H2,(H,16,18)(H,19,20) |
| InChIKey | IFYUMCRFSLHNJZ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |