C13H17ClN2O5 — CID 3379069
4-(5-chloro-2-methoxyanilino)-2-(2-hydroxyethylamino)-4-oxobutanoic acid (PubChem CID 3379069) has the molecular formula C13H17ClN2O5 and a molecular weight of 316.74 g/mol. Its IUPAC name is 4-(5-chloro-2-methoxyanilino)-2-(2-hydroxyethylamino)-4-oxobutanoic acid.
| Compound Name | 4-(5-chloro-2-methoxyanilino)-2-(2-hydroxyethylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 3379069 |
| Molecular Formula | C13H17ClN2O5 |
| Molecular Weight | 316.74 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 4-(5-chloro-2-methoxyanilino)-2-(2-hydroxyethylamino)-4-oxobutanoic acid |
| SMILES | COc1ccc(Cl)cc1NC(=O)CC(NCCO)C(=O)O |
| InChI | InChI=1S/C13H17ClN2O5/c1-21-11-3-2-8(14)6-9(11)16-12(18)7-10(13(19)20)15-4-5-17/h2-3,6,10,15,17H,4-5,7H2,1H3,(H,16,18)(H,19,20) |
| InChIKey | BYBVGHPUYJLZHN-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.74 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |