C16H22ClN3O4 — CID 16803555
4-(5-chloro-2-methoxyanilino)-2-(4-methylpiperazin-1-yl)-4-oxobutanoic acid (PubChem CID 16803555) has the molecular formula C16H22ClN3O4 and a molecular weight of 355.82 g/mol. Its IUPAC name is 4-(5-chloro-2-methoxyanilino)-2-(4-methylpiperazin-1-yl)-4-oxobutanoic acid.
| Compound Name | 4-(5-chloro-2-methoxyanilino)-2-(4-methylpiperazin-1-yl)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 16803555 |
| Molecular Formula | C16H22ClN3O4 |
| Molecular Weight | 355.82 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 4-(5-chloro-2-methoxyanilino)-2-(4-methylpiperazin-1-yl)-4-oxobutanoic acid |
| SMILES | COc1ccc(Cl)cc1NC(=O)CC(C(=O)O)N1CCN(C)CC1 |
| InChI | InChI=1S/C16H22ClN3O4/c1-19-5-7-20(8-6-19)13(16(22)23)10-15(21)18-12-9-11(17)3-4-14(12)24-2/h3-4,9,13H,5-8,10H2,1-2H3,(H,18,21)(H,22,23) |
| InChIKey | JWRLEHSKLVJRGH-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.82 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |