C20H25ClN4O2 — CID 109008899
N-(5-chloro-2-methoxyphenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]acetamide (PubChem CID 109008899) has the molecular formula C20H25ClN4O2 and a molecular weight of 388.90 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]acetamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]acetamide |
|---|---|
| PubChem CID | 109008899 |
| Molecular Formula | C20H25ClN4O2 |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]acetamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)CNc1ccc(N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C20H25ClN4O2/c1-24-9-11-25(12-10-24)17-6-4-16(5-7-17)22-14-20(26)23-18-13-15(21)3-8-19(18)27-2/h3-8,13,22H,9-12,14H2,1-2H3,(H,23,26) |
| InChIKey | JZIBLVKTNXRAPW-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|