C23H32N4O — CID 109008238
N-(2-tert-butylphenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]acetamide (PubChem CID 109008238) has the molecular formula C23H32N4O and a molecular weight of 380.54 g/mol. Its IUPAC name is N-(2-tert-butylphenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]acetamide.
| Compound Name | N-(2-tert-butylphenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]acetamide |
|---|---|
| PubChem CID | 109008238 |
| Molecular Formula | C23H32N4O |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | N-(2-tert-butylphenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]acetamide |
| SMILES | CN1CCN(c2ccc(NCC(=O)Nc3ccccc3C(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C23H32N4O/c1-23(2,3)20-7-5-6-8-21(20)25-22(28)17-24-18-9-11-19(12-10-18)27-15-13-26(4)14-16-27/h5-12,24H,13-17H2,1-4H3,(H,25,28) |
| InChIKey | HGIVFCUINFDMFS-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|