C21H28N4O — CID 109007621
2-(2-ethylanilino)-N-[4-(4-methylpiperazin-1-yl)phenyl]acetamide (PubChem CID 109007621) has the molecular formula C21H28N4O and a molecular weight of 352.48 g/mol. Its IUPAC name is 2-(2-ethylanilino)-N-[4-(4-methylpiperazin-1-yl)phenyl]acetamide.
| Compound Name | 2-(2-ethylanilino)-N-[4-(4-methylpiperazin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 109007621 |
| Molecular Formula | C21H28N4O |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | 2-(2-ethylanilino)-N-[4-(4-methylpiperazin-1-yl)phenyl]acetamide |
| SMILES | CCc1ccccc1NCC(=O)Nc1ccc(N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C21H28N4O/c1-3-17-6-4-5-7-20(17)22-16-21(26)23-18-8-10-19(11-9-18)25-14-12-24(2)13-15-25/h4-11,22H,3,12-16H2,1-2H3,(H,23,26) |
| InChIKey | MTNZQKBAQWKDFR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|