C17H27N3O5 — CID 7591987
(2S)-4-(2,5-dimethoxyanilino)-2-[3-(dimethylamino)propylamino]-4-oxobutanoic acid (PubChem CID 7591987) has the molecular formula C17H27N3O5 and a molecular weight of 353.42 g/mol. Its IUPAC name is (2S)-4-(2,5-dimethoxyanilino)-2-[3-(dimethylamino)propylamino]-4-oxobutanoic acid.
| Compound Name | (2S)-4-(2,5-dimethoxyanilino)-2-[3-(dimethylamino)propylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 7591987 |
| Molecular Formula | C17H27N3O5 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | (2S)-4-(2,5-dimethoxyanilino)-2-[3-(dimethylamino)propylamino]-4-oxobutanoic acid |
| SMILES | COc1ccc(OC)c(NC(=O)C[C@H](NCCCN(C)C)C(=O)O)c1 |
| InChI | InChI=1S/C17H27N3O5/c1-20(2)9-5-8-18-14(17(22)23)11-16(21)19-13-10-12(24-3)6-7-15(13)25-4/h6-7,10,14,18H,5,8-9,11H2,1-4H3,(H,19,21)(H,22,23)/t14-/m0/s1 |
| InChIKey | OWWFJUWDFZAMGM-AWEZNQCLSA-N |
| XLogP | 1.03 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|