C17H25N3O6 — CID 18858519
2-(hexylamino)-4-(2-methoxy-5-nitroanilino)-4-oxobutanoic acid (PubChem CID 18858519) has the molecular formula C17H25N3O6 and a molecular weight of 367.40 g/mol. Its IUPAC name is 2-(hexylamino)-4-(2-methoxy-5-nitroanilino)-4-oxobutanoic acid.
| Compound Name | 2-(hexylamino)-4-(2-methoxy-5-nitroanilino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18858519 |
| Molecular Formula | C17H25N3O6 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 2-(hexylamino)-4-(2-methoxy-5-nitroanilino)-4-oxobutanoic acid |
| SMILES | CCCCCCNC(CC(=O)Nc1cc([N+](=O)[O-])ccc1OC)C(=O)O |
| InChI | InChI=1S/C17H25N3O6/c1-3-4-5-6-9-18-14(17(22)23)11-16(21)19-13-10-12(20(24)25)7-8-15(13)26-2/h7-8,10,14,18H,3-6,9,11H2,1-2H3,(H,19,21)(H,22,23) |
| InChIKey | VQROIAWKZJELTD-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|