C16H24N4O6 — CID 66491276
4-(2-amino-5-nitroanilino)-4-oxo-2-(3-propan-2-yloxypropylamino)butanoic acid (PubChem CID 66491276) has the molecular formula C16H24N4O6 and a molecular weight of 368.39 g/mol. Its IUPAC name is 4-(2-amino-5-nitroanilino)-4-oxo-2-(3-propan-2-yloxypropylamino)butanoic acid.
| Compound Name | 4-(2-amino-5-nitroanilino)-4-oxo-2-(3-propan-2-yloxypropylamino)butanoic acid |
|---|---|
| PubChem CID | 66491276 |
| Molecular Formula | C16H24N4O6 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 4-(2-amino-5-nitroanilino)-4-oxo-2-(3-propan-2-yloxypropylamino)butanoic acid |
| SMILES | CC(C)OCCCNC(CC(=O)Nc1cc([N+](=O)[O-])ccc1N)C(=O)O |
| InChI | InChI=1S/C16H24N4O6/c1-10(2)26-7-3-6-18-14(16(22)23)9-15(21)19-13-8-11(20(24)25)4-5-12(13)17/h4-5,8,10,14,18H,3,6-7,9,17H2,1-2H3,(H,19,21)(H,22,23) |
| InChIKey | IBOMLTRKQJOOPU-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 156.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|