C18H28N2O4 — CID 7421967
(2R)-4-(4-ethylanilino)-4-oxo-2-(3-propan-2-yloxypropylamino)butanoic acid (PubChem CID 7421967) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is (2R)-4-(4-ethylanilino)-4-oxo-2-(3-propan-2-yloxypropylamino)butanoic acid.
| Compound Name | (2R)-4-(4-ethylanilino)-4-oxo-2-(3-propan-2-yloxypropylamino)butanoic acid |
|---|---|
| PubChem CID | 7421967 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | (2R)-4-(4-ethylanilino)-4-oxo-2-(3-propan-2-yloxypropylamino)butanoic acid |
| SMILES | CCc1ccc(NC(=O)C[C@@H](NCCCOC(C)C)C(=O)O)cc1 |
| InChI | InChI=1S/C18H28N2O4/c1-4-14-6-8-15(9-7-14)20-17(21)12-16(18(22)23)19-10-5-11-24-13(2)3/h6-9,13,16,19H,4-5,10-12H2,1-3H3,(H,20,21)(H,22,23)/t16-/m1/s1 |
| InChIKey | LQLKTOKQNPRTFJ-MRXNPFEDSA-N |
| XLogP | 2.44 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|