C21H27N3O3 — CID 7591405
(2R)-4-(4-anilinoanilino)-4-oxo-2-(pentylamino)butanoic acid (PubChem CID 7591405) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is (2R)-4-(4-anilinoanilino)-4-oxo-2-(pentylamino)butanoic acid.
| Compound Name | (2R)-4-(4-anilinoanilino)-4-oxo-2-(pentylamino)butanoic acid |
|---|---|
| PubChem CID | 7591405 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | (2R)-4-(4-anilinoanilino)-4-oxo-2-(pentylamino)butanoic acid |
| SMILES | CCCCCN[C@H](CC(=O)Nc1ccc(Nc2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C21H27N3O3/c1-2-3-7-14-22-19(21(26)27)15-20(25)24-18-12-10-17(11-13-18)23-16-8-5-4-6-9-16/h4-6,8-13,19,22-23H,2-3,7,14-15H2,1H3,(H,24,25)(H,26,27)/t19-/m1/s1 |
| InChIKey | NWUUGXHSRDEUPF-LJQANCHMSA-N |
| XLogP | 3.99 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|