C20H33N3O3 — CID 7590943
(2R)-2-(6-aminohexylamino)-4-(4-butylanilino)-4-oxobutanoic acid (PubChem CID 7590943) has the molecular formula C20H33N3O3 and a molecular weight of 363.50 g/mol. Its IUPAC name is (2R)-2-(6-aminohexylamino)-4-(4-butylanilino)-4-oxobutanoic acid.
| Compound Name | (2R)-2-(6-aminohexylamino)-4-(4-butylanilino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 7590943 |
| Molecular Formula | C20H33N3O3 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.25 |
| IUPAC Name | (2R)-2-(6-aminohexylamino)-4-(4-butylanilino)-4-oxobutanoic acid |
| SMILES | CCCCc1ccc(NC(=O)C[C@@H](NCCCCCCN)C(=O)O)cc1 |
| InChI | InChI=1S/C20H33N3O3/c1-2-3-8-16-9-11-17(12-10-16)23-19(24)15-18(20(25)26)22-14-7-5-4-6-13-21/h9-12,18,22H,2-8,13-15,21H2,1H3,(H,23,24)(H,25,26)/t18-/m1/s1 |
| InChIKey | WSFDMZGCPSASAS-GOSISDBHSA-N |
| XLogP | 2.92 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|