C22H29N3O3 — CID 18581013
4-(4-anilinoanilino)-2-(hexylamino)-4-oxobutanoic acid (PubChem CID 18581013) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is 4-(4-anilinoanilino)-2-(hexylamino)-4-oxobutanoic acid.
| Compound Name | 4-(4-anilinoanilino)-2-(hexylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18581013 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 4-(4-anilinoanilino)-2-(hexylamino)-4-oxobutanoic acid |
| SMILES | CCCCCCNC(CC(=O)Nc1ccc(Nc2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C22H29N3O3/c1-2-3-4-8-15-23-20(22(27)28)16-21(26)25-19-13-11-18(12-14-19)24-17-9-6-5-7-10-17/h5-7,9-14,20,23-24H,2-4,8,15-16H2,1H3,(H,25,26)(H,27,28) |
| InChIKey | KIVIEDPDAOKSIQ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|