C19H23N3O4 — CID 7591377
(2R)-4-(4-anilinoanilino)-2-(2-methoxyethylamino)-4-oxobutanoic acid (PubChem CID 7591377) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is (2R)-4-(4-anilinoanilino)-2-(2-methoxyethylamino)-4-oxobutanoic acid.
| Compound Name | (2R)-4-(4-anilinoanilino)-2-(2-methoxyethylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 7591377 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | (2R)-4-(4-anilinoanilino)-2-(2-methoxyethylamino)-4-oxobutanoic acid |
| SMILES | COCCN[C@H](CC(=O)Nc1ccc(Nc2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C19H23N3O4/c1-26-12-11-20-17(19(24)25)13-18(23)22-16-9-7-15(8-10-16)21-14-5-3-2-4-6-14/h2-10,17,20-21H,11-13H2,1H3,(H,22,23)(H,24,25)/t17-/m1/s1 |
| InChIKey | DDONDVNYJUOIJP-QGZVFWFLSA-N |
| XLogP | 2.45 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|