C20H25N3O6S — CID 66491338
2-(2-methoxyethylamino)-4-[4-[(4-methylphenyl)sulfamoyl]anilino]-4-oxobutanoic acid (PubChem CID 66491338) has the molecular formula C20H25N3O6S and a molecular weight of 435.50 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-4-[4-[(4-methylphenyl)sulfamoyl]anilino]-4-oxobutanoic acid.
| Compound Name | 2-(2-methoxyethylamino)-4-[4-[(4-methylphenyl)sulfamoyl]anilino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 66491338 |
| Molecular Formula | C20H25N3O6S |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 2-(2-methoxyethylamino)-4-[4-[(4-methylphenyl)sulfamoyl]anilino]-4-oxobutanoic acid |
| SMILES | COCCNC(CC(=O)Nc1ccc(S(=O)(=O)Nc2ccc(C)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C20H25N3O6S/c1-14-3-5-16(6-4-14)23-30(27,28)17-9-7-15(8-10-17)22-19(24)13-18(20(25)26)21-11-12-29-2/h3-10,18,21,23H,11-13H2,1-2H3,(H,22,24)(H,25,26) |
| InChIKey | ARTMUCYHGHPPDC-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|