C20H25N3O3 — CID 7590858
(2S)-2-[2-(benzylamino)ethylamino]-4-(4-methylanilino)-4-oxobutanoic acid (PubChem CID 7590858) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is (2S)-2-[2-(benzylamino)ethylamino]-4-(4-methylanilino)-4-oxobutanoic acid.
| Compound Name | (2S)-2-[2-(benzylamino)ethylamino]-4-(4-methylanilino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 7590858 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | (2S)-2-[2-(benzylamino)ethylamino]-4-(4-methylanilino)-4-oxobutanoic acid |
| SMILES | Cc1ccc(NC(=O)C[C@H](NCCNCc2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C20H25N3O3/c1-15-7-9-17(10-8-15)23-19(24)13-18(20(25)26)22-12-11-21-14-16-5-3-2-4-6-16/h2-10,18,21-22H,11-14H2,1H3,(H,23,24)(H,25,26)/t18-/m0/s1 |
| InChIKey | NPGGHGMJZWCGJJ-SFHVURJKSA-N |
| XLogP | 2.16 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|