C16H23ClN2O4 — CID 18580979
4-(2-chloroanilino)-4-oxo-2-(3-propan-2-yloxypropylamino)butanoic acid (PubChem CID 18580979) has the molecular formula C16H23ClN2O4 and a molecular weight of 342.82 g/mol. Its IUPAC name is 4-(2-chloroanilino)-4-oxo-2-(3-propan-2-yloxypropylamino)butanoic acid.
| Compound Name | 4-(2-chloroanilino)-4-oxo-2-(3-propan-2-yloxypropylamino)butanoic acid |
|---|---|
| PubChem CID | 18580979 |
| Molecular Formula | C16H23ClN2O4 |
| Molecular Weight | 342.82 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 4-(2-chloroanilino)-4-oxo-2-(3-propan-2-yloxypropylamino)butanoic acid |
| SMILES | CC(C)OCCCNC(CC(=O)Nc1ccccc1Cl)C(=O)O |
| InChI | InChI=1S/C16H23ClN2O4/c1-11(2)23-9-5-8-18-14(16(21)22)10-15(20)19-13-7-4-3-6-12(13)17/h3-4,6-7,11,14,18H,5,8-10H2,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | FZMMTFAWPYQAOJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.82 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|