C21H25N3O7 — CID 18858284
2-[2-(3,4-dimethoxyphenyl)ethylamino]-4-(2-methyl-5-nitroanilino)-4-oxobutanoic acid (PubChem CID 18858284) has the molecular formula C21H25N3O7 and a molecular weight of 431.45 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)ethylamino]-4-(2-methyl-5-nitroanilino)-4-oxobutanoic acid.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)ethylamino]-4-(2-methyl-5-nitroanilino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18858284 |
| Molecular Formula | C21H25N3O7 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)ethylamino]-4-(2-methyl-5-nitroanilino)-4-oxobutanoic acid |
| SMILES | COc1ccc(CCNC(CC(=O)Nc2cc([N+](=O)[O-])ccc2C)C(=O)O)cc1OC |
| InChI | InChI=1S/C21H25N3O7/c1-13-4-6-15(24(28)29)11-16(13)23-20(25)12-17(21(26)27)22-9-8-14-5-7-18(30-2)19(10-14)31-3/h4-7,10-11,17,22H,8-9,12H2,1-3H3,(H,23,25)(H,26,27) |
| InChIKey | MSBHRMBVZHDCKB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 140.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|