C17H18N4O6 — CID 18858510
4-(2-methoxy-5-nitroanilino)-4-oxo-2-(pyridin-2-ylmethylamino)butanoic acid (PubChem CID 18858510) has the molecular formula C17H18N4O6 and a molecular weight of 374.35 g/mol. Its IUPAC name is 4-(2-methoxy-5-nitroanilino)-4-oxo-2-(pyridin-2-ylmethylamino)butanoic acid.
| Compound Name | 4-(2-methoxy-5-nitroanilino)-4-oxo-2-(pyridin-2-ylmethylamino)butanoic acid |
|---|---|
| PubChem CID | 18858510 |
| Molecular Formula | C17H18N4O6 |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 4-(2-methoxy-5-nitroanilino)-4-oxo-2-(pyridin-2-ylmethylamino)butanoic acid |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)CC(NCc1ccccn1)C(=O)O |
| InChI | InChI=1S/C17H18N4O6/c1-27-15-6-5-12(21(25)26)8-13(15)20-16(22)9-14(17(23)24)19-10-11-4-2-3-7-18-11/h2-8,14,19H,9-10H2,1H3,(H,20,22)(H,23,24) |
| InChIKey | NKEZMDYHSULCSZ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 143.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|