C20H19N3O3 — CID 18886284
4-(naphthalen-2-ylamino)-4-oxo-2-(pyridin-2-ylmethylamino)butanoic acid (PubChem CID 18886284) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is 4-(naphthalen-2-ylamino)-4-oxo-2-(pyridin-2-ylmethylamino)butanoic acid.
| Compound Name | 4-(naphthalen-2-ylamino)-4-oxo-2-(pyridin-2-ylmethylamino)butanoic acid |
|---|---|
| PubChem CID | 18886284 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 4-(naphthalen-2-ylamino)-4-oxo-2-(pyridin-2-ylmethylamino)butanoic acid |
| SMILES | O=C(CC(NCc1ccccn1)C(=O)O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H19N3O3/c24-19(23-16-9-8-14-5-1-2-6-15(14)11-16)12-18(20(25)26)22-13-17-7-3-4-10-21-17/h1-11,18,22H,12-13H2,(H,23,24)(H,25,26) |
| InChIKey | RBSSLYOXXZSITC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |