C17H19N3O3 — CID 68875961
(2S)-3-phenyl-2-[[2-(pyridin-2-ylmethylamino)acetyl]amino]propanoic acid (PubChem CID 68875961) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is (2S)-3-phenyl-2-[[2-(pyridin-2-ylmethylamino)acetyl]amino]propanoic acid.
| Compound Name | (2S)-3-phenyl-2-[[2-(pyridin-2-ylmethylamino)acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 68875961 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | (2S)-3-phenyl-2-[[2-(pyridin-2-ylmethylamino)acetyl]amino]propanoic acid |
| SMILES | O=C(CNCc1ccccn1)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C17H19N3O3/c21-16(12-18-11-14-8-4-5-9-19-14)20-15(17(22)23)10-13-6-2-1-3-7-13/h1-9,15,18H,10-12H2,(H,20,21)(H,22,23)/t15-/m0/s1 |
| InChIKey | XMKWHYMGQCTNEH-HNNXBMFYSA-N |
| XLogP | 0.98 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |