C21H27N3O3 — CID 68875721
tert-butyl (2S)-3-phenyl-2-[[2-(pyridin-2-ylmethylamino)acetyl]amino]propanoate (PubChem CID 68875721) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is tert-butyl (2S)-3-phenyl-2-[[2-(pyridin-2-ylmethylamino)acetyl]amino]propanoate.
| Compound Name | tert-butyl (2S)-3-phenyl-2-[[2-(pyridin-2-ylmethylamino)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 68875721 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | tert-butyl (2S)-3-phenyl-2-[[2-(pyridin-2-ylmethylamino)acetyl]amino]propanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](Cc1ccccc1)NC(=O)CNCc1ccccn1 |
| InChI | InChI=1S/C21H27N3O3/c1-21(2,3)27-20(26)18(13-16-9-5-4-6-10-16)24-19(25)15-22-14-17-11-7-8-12-23-17/h4-12,18,22H,13-15H2,1-3H3,(H,24,25)/t18-/m0/s1 |
| InChIKey | NARQNUCBCGTDCX-SFHVURJKSA-N |
| XLogP | 2.24 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |