C26H32N2O7 — CID 70445877
tert-butyl (2S)-2-[[2-(2,3-dihydro-1H-inden-2-ylamino)acetyl]amino]-3-phenylpropanoate;oxalic acid (PubChem CID 70445877) has the molecular formula C26H32N2O7 and a molecular weight of 484.55 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[2-(2,3-dihydro-1H-inden-2-ylamino)acetyl]amino]-3-phenylpropanoate;oxalic acid.
| Compound Name | tert-butyl (2S)-2-[[2-(2,3-dihydro-1H-inden-2-ylamino)acetyl]amino]-3-phenylpropanoate;oxalic acid |
|---|---|
| PubChem CID | 70445877 |
| Molecular Formula | C26H32N2O7 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | tert-butyl (2S)-2-[[2-(2,3-dihydro-1H-inden-2-ylamino)acetyl]amino]-3-phenylpropanoate;oxalic acid |
| SMILES | CC(C)(C)OC(=O)[C@H](Cc1ccccc1)NC(=O)CNC1Cc2ccccc2C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C24H30N2O3.C2H2O4/c1-24(2,3)29-23(28)21(13-17-9-5-4-6-10-17)26-22(27)16-25-20-14-18-11-7-8-12-19(18)15-20;3-1(4)2(5)6/h4-12,20-21,25H,13-16H2,1-3H3,(H,26,27);(H,3,4)(H,5,6)/t21-;/m0./s1 |
| InChIKey | CIVZARLRHAKTDJ-BOXHHOBZSA-N |
| XLogP | 1.97 |
| TPSA | 142.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|