C28H31NO5 — CID 146503537
tert-butyl (2S)-2-[4-(3-methyl-1,4-dioxonaphthalen-2-yl)butanoylamino]-3-phenylpropanoate (PubChem CID 146503537) has the molecular formula C28H31NO5 and a molecular weight of 461.56 g/mol. Its IUPAC name is tert-butyl (2S)-2-[4-(3-methyl-1,4-dioxonaphthalen-2-yl)butanoylamino]-3-phenylpropanoate.
| Compound Name | tert-butyl (2S)-2-[4-(3-methyl-1,4-dioxonaphthalen-2-yl)butanoylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 146503537 |
| Molecular Formula | C28H31NO5 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | tert-butyl (2S)-2-[4-(3-methyl-1,4-dioxonaphthalen-2-yl)butanoylamino]-3-phenylpropanoate |
| SMILES | CC1=C(CCCC(=O)N[C@@H](Cc2ccccc2)C(=O)OC(C)(C)C)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C28H31NO5/c1-18-20(26(32)22-14-9-8-13-21(22)25(18)31)15-10-16-24(30)29-23(27(33)34-28(2,3)4)17-19-11-6-5-7-12-19/h5-9,11-14,23H,10,15-17H2,1-4H3,(H,29,30)/t23-/m0/s1 |
| InChIKey | XURJVBCXIYLMNW-QHCPKHFHSA-N |
| XLogP | 4.62 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|