C29H32O6 — CID 148567465
tert-butyl (2R)-2-[(4-hydroxyphenyl)methyl]-7-(3-methyl-1,4-dioxonaphthalen-2-yl)-4-oxoheptanoate (PubChem CID 148567465) has the molecular formula C29H32O6 and a molecular weight of 476.57 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(4-hydroxyphenyl)methyl]-7-(3-methyl-1,4-dioxonaphthalen-2-yl)-4-oxoheptanoate.
| Compound Name | tert-butyl (2R)-2-[(4-hydroxyphenyl)methyl]-7-(3-methyl-1,4-dioxonaphthalen-2-yl)-4-oxoheptanoate |
|---|---|
| PubChem CID | 148567465 |
| Molecular Formula | C29H32O6 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | tert-butyl (2R)-2-[(4-hydroxyphenyl)methyl]-7-(3-methyl-1,4-dioxonaphthalen-2-yl)-4-oxoheptanoate |
| SMILES | CC1=C(CCCC(=O)C[C@@H](Cc2ccc(O)cc2)C(=O)OC(C)(C)C)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C29H32O6/c1-18-23(27(33)25-10-6-5-9-24(25)26(18)32)11-7-8-22(31)17-20(28(34)35-29(2,3)4)16-19-12-14-21(30)15-13-19/h5-6,9-10,12-15,20,30H,7-8,11,16-17H2,1-4H3/t20-/m1/s1 |
| InChIKey | MWFBUBLLSXCGIO-HXUWFJFHSA-N |
| XLogP | 5.42 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|