C16H17NO3 — CID 71479860
N-[3-(3-methyl-1,4-dioxonaphthalen-2-yl)propyl]acetamide (PubChem CID 71479860) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is N-[3-(3-methyl-1,4-dioxonaphthalen-2-yl)propyl]acetamide.
| Compound Name | N-[3-(3-methyl-1,4-dioxonaphthalen-2-yl)propyl]acetamide |
|---|---|
| PubChem CID | 71479860 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | N-[3-(3-methyl-1,4-dioxonaphthalen-2-yl)propyl]acetamide |
| SMILES | CC(=O)NCCCC1=C(C)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H17NO3/c1-10-12(8-5-9-17-11(2)18)16(20)14-7-4-3-6-13(14)15(10)19/h3-4,6-7H,5,8-9H2,1-2H3,(H,17,18) |
| InChIKey | GWJHYPHWFALXHG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|