C16H19ClN2O4 — CID 68918611
(2S,3R)-2-amino-3-hydroxy-N-[(3-methyl-1,4-dioxonaphthalen-2-yl)methyl]butanamide;hydrochloride (PubChem CID 68918611) has the molecular formula C16H19ClN2O4 and a molecular weight of 338.79 g/mol. Its IUPAC name is (2S,3R)-2-amino-3-hydroxy-N-[(3-methyl-1,4-dioxonaphthalen-2-yl)methyl]butanamide;hydrochloride.
| Compound Name | (2S,3R)-2-amino-3-hydroxy-N-[(3-methyl-1,4-dioxonaphthalen-2-yl)methyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 68918611 |
| Molecular Formula | C16H19ClN2O4 |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | (2S,3R)-2-amino-3-hydroxy-N-[(3-methyl-1,4-dioxonaphthalen-2-yl)methyl]butanamide;hydrochloride |
| SMILES | CC1=C(CNC(=O)[C@@H](N)[C@@H](C)O)C(=O)c2ccccc2C1=O.Cl |
| InChI | InChI=1S/C16H18N2O4.ClH/c1-8-12(7-18-16(22)13(17)9(2)19)15(21)11-6-4-3-5-10(11)14(8)20;/h3-6,9,13,19H,7,17H2,1-2H3,(H,18,22);1H/t9-,13+;/m1./s1 |
| InChIKey | GALLMUQVEYGMMK-XVUIFDSFSA-N |
| XLogP | 0.63 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|