C15H17ClN2O3 — CID 157115941
2-(2,4-diamino-3-oxobutyl)-3-methylnaphthalene-1,4-dione;hydrochloride (PubChem CID 157115941) has the molecular formula C15H17ClN2O3 and a molecular weight of 308.77 g/mol. Its IUPAC name is 2-(2,4-diamino-3-oxobutyl)-3-methylnaphthalene-1,4-dione;hydrochloride.
| Compound Name | 2-(2,4-diamino-3-oxobutyl)-3-methylnaphthalene-1,4-dione;hydrochloride |
|---|---|
| PubChem CID | 157115941 |
| Molecular Formula | C15H17ClN2O3 |
| Molecular Weight | 308.77 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 2-(2,4-diamino-3-oxobutyl)-3-methylnaphthalene-1,4-dione;hydrochloride |
| SMILES | CC1=C(CC(N)C(=O)CN)C(=O)c2ccccc2C1=O.Cl |
| InChI | InChI=1S/C15H16N2O3.ClH/c1-8-11(6-12(17)13(18)7-16)15(20)10-5-3-2-4-9(10)14(8)19;/h2-5,12H,6-7,16-17H2,1H3;1H |
| InChIKey | YAVUPDSQSDJWSX-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 103.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.77 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|