About 2-(2,4-diamino-3-oxobutyl)-3-methylnaphthalene-1,4-dione;hydrochloride
2-(2,4-diamino-3-oxobutyl)-3-methylnaphthalene-1,4-dione;hydrochloride (PubChem CID 157115941) has the molecular formula C15H17ClN2O3
and a molecular weight of 308.77 g/mol. Its IUPAC name is 2-(2,4-diamino-3-oxobutyl)-3-methylnaphthalene-1,4-dione;hydrochloride.
Molecular Properties
| Compound Name | 2-(2,4-diamino-3-oxobutyl)-3-methylnaphthalene-1,4-dione;hydrochloride |
| PubChem CID | 157115941 |
| Molecular Formula | C15H17ClN2O3 |
| Molecular Weight | 308.77 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 2-(2,4-diamino-3-oxobutyl)-3-methylnaphthalene-1,4-dione;hydrochloride |
| SMILES | CC1=C(CC(N)C(=O)CN)C(=O)c2ccccc2C1=O.Cl |
| InChI | InChI=1S/C15H16N2O3.ClH/c1-8-11(6-12(17)13(18)7-16)15(20)10-5-3-2-4-9(10)14(8)19;/h2-5,12H,6-7,16-17H2,1H3;1H |
| InChIKey | YAVUPDSQSDJWSX-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 103.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.77 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,4-diamino-3-oxobutyl)-3-methylnaphthalene-1,4-dione;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-diamino-3-oxobutyl)-3-methylnaphthalene-1,4-dione;hydrochloride?
The IUPAC name of 2-(2,4-diamino-3-oxobutyl)-3-methylnaphthalene-1,4-dione;hydrochloride (CID 157115941) is 2-(2,4-diamino-3-oxobutyl)-3-methylnaphthalene-1,4-dione;hydrochloride.
What is the SMILES notation for 2-(2,4-diamino-3-oxobutyl)-3-methylnaphthalene-1,4-dione;hydrochloride?
The canonical SMILES for 2-(2,4-diamino-3-oxobutyl)-3-methylnaphthalene-1,4-dione;hydrochloride is CC1=C(CC(N)C(=O)CN)C(=O)c2ccccc2C1=O.Cl.
What is the InChIKey of 2-(2,4-diamino-3-oxobutyl)-3-methylnaphthalene-1,4-dione;hydrochloride?
The InChIKey is YAVUPDSQSDJWSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O3.ClH/c1-8-11(6-12(17)13(18)7-16)15(20)10-5-3-2-4-9(10)14(8)19;/h2-5,12H,6-7,16-17H2,1H3;1H.
What are the key properties of 2-(2,4-diamino-3-oxobutyl)-3-methylnaphthalene-1,4-dione;hydrochloride?
2-(2,4-diamino-3-oxobutyl)-3-methylnaphthalene-1,4-dione;hydrochloride has a molecular weight of 308.77 g/mol, XLogP of 1.05, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-diamino-3-oxobutyl)-3-methylnaphthalene-1,4-dione;hydrochloride is sourced from PubChem (CID 157115941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).