C13H10O3 — CID 134866818
2-(3-methyl-1,4-dioxonaphthalen-2-yl)acetaldehyde (PubChem CID 134866818) has the molecular formula C13H10O3 and a molecular weight of 214.22 g/mol. Its IUPAC name is 2-(3-methyl-1,4-dioxonaphthalen-2-yl)acetaldehyde.
| Compound Name | 2-(3-methyl-1,4-dioxonaphthalen-2-yl)acetaldehyde |
|---|---|
| PubChem CID | 134866818 |
| Molecular Formula | C13H10O3 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 2-(3-methyl-1,4-dioxonaphthalen-2-yl)acetaldehyde |
| SMILES | CC1=C(CC=O)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C13H10O3/c1-8-9(6-7-14)13(16)11-5-3-2-4-10(11)12(8)15/h2-5,7H,6H2,1H3 |
| InChIKey | KRUXWRWFGHJJOO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|