C17H18N2O2 — CID 155412099
2-[(2Z,4Z)-2,5-diaminohexa-2,4-dienyl]-3-methylnaphthalene-1,4-dione (PubChem CID 155412099) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is 2-[(2Z,4Z)-2,5-diaminohexa-2,4-dienyl]-3-methylnaphthalene-1,4-dione.
| Compound Name | 2-[(2Z,4Z)-2,5-diaminohexa-2,4-dienyl]-3-methylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 155412099 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 2-[(2Z,4Z)-2,5-diaminohexa-2,4-dienyl]-3-methylnaphthalene-1,4-dione |
| SMILES | CC1=C(C/C(N)=C/C=C(/C)N)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H18N2O2/c1-10(18)7-8-12(19)9-15-11(2)16(20)13-5-3-4-6-14(13)17(15)21/h3-8H,9,18-19H2,1-2H3/b10-7-,12-8- |
| InChIKey | QTQKSTASYJCLIC-NQXFEYKRSA-N |
| XLogP | 2.48 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|