C18H14O3S — CID 162658724
2-methyl-3-[2-(3-methylthiophen-2-yl)-2-oxoethyl]naphthalene-1,4-dione (PubChem CID 162658724) has the molecular formula C18H14O3S and a molecular weight of 310.37 g/mol. Its IUPAC name is 2-methyl-3-[2-(3-methylthiophen-2-yl)-2-oxoethyl]naphthalene-1,4-dione.
| Compound Name | 2-methyl-3-[2-(3-methylthiophen-2-yl)-2-oxoethyl]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 162658724 |
| Molecular Formula | C18H14O3S |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 2-methyl-3-[2-(3-methylthiophen-2-yl)-2-oxoethyl]naphthalene-1,4-dione |
| SMILES | CC1=C(CC(=O)c2sccc2C)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H14O3S/c1-10-7-8-22-18(10)15(19)9-14-11(2)16(20)12-5-3-4-6-13(12)17(14)21/h3-8H,9H2,1-2H3 |
| InChIKey | GTDUZUJRCJPOHY-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|