C21H24O3 — CID 73388941
2-[(5E,8E)-10-hydroxydeca-5,8-dienyl]-3-methylnaphthalene-1,4-dione (PubChem CID 73388941) has the molecular formula C21H24O3 and a molecular weight of 324.42 g/mol. Its IUPAC name is 2-[(5E,8E)-10-hydroxydeca-5,8-dienyl]-3-methylnaphthalene-1,4-dione.
| Compound Name | 2-[(5E,8E)-10-hydroxydeca-5,8-dienyl]-3-methylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 73388941 |
| Molecular Formula | C21H24O3 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 2-[(5E,8E)-10-hydroxydeca-5,8-dienyl]-3-methylnaphthalene-1,4-dione |
| SMILES | CC1=C(CCCC/C=C/C/C=C/CO)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H24O3/c1-16-17(12-8-6-4-2-3-5-7-11-15-22)21(24)19-14-10-9-13-18(19)20(16)23/h2-3,7,9-11,13-14,22H,4-6,8,12,15H2,1H3/b3-2+,11-7+ |
| InChIKey | WAXIFTIATZBGGS-LFWRRJNUSA-N |
| XLogP | 4.44 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|