C16H16O4 — CID 3082405
2-methyl-4-(3-methyl-1,4-dioxonaphthalen-2-yl)butanoic acid (PubChem CID 3082405) has the molecular formula C16H16O4 and a molecular weight of 272.30 g/mol. Its IUPAC name is 2-methyl-4-(3-methyl-1,4-dioxonaphthalen-2-yl)butanoic acid.
| Compound Name | 2-methyl-4-(3-methyl-1,4-dioxonaphthalen-2-yl)butanoic acid |
|---|---|
| PubChem CID | 3082405 |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 2-methyl-4-(3-methyl-1,4-dioxonaphthalen-2-yl)butanoic acid |
| SMILES | CC1=C(CCC(C)C(=O)O)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H16O4/c1-9(16(19)20)7-8-11-10(2)14(17)12-5-3-4-6-13(12)15(11)18/h3-6,9H,7-8H2,1-2H3,(H,19,20) |
| InChIKey | ALLYVKRLOHDVKI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|