C31H52O2 — CID 142867631
ethane;2-(3,4,4,8,9,9-hexamethyldecyl)-3-methylnaphthalene-1,4-dione (PubChem CID 142867631) has the molecular formula C31H52O2 and a molecular weight of 456.76 g/mol. Its IUPAC name is ethane;2-(3,4,4,8,9,9-hexamethyldecyl)-3-methylnaphthalene-1,4-dione.
| Compound Name | ethane;2-(3,4,4,8,9,9-hexamethyldecyl)-3-methylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 142867631 |
| Molecular Formula | C31H52O2 |
| Molecular Weight | 456.76 g/mol |
| Exact Mass | 456.40 |
| IUPAC Name | ethane;2-(3,4,4,8,9,9-hexamethyldecyl)-3-methylnaphthalene-1,4-dione |
| SMILES | CC.CC.CC1=C(CCC(C)C(C)(C)CCCC(C)C(C)(C)C)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C27H40O2.2C2H6/c1-18(26(4,5)6)12-11-17-27(7,8)19(2)15-16-21-20(3)24(28)22-13-9-10-14-23(22)25(21)29;2*1-2/h9-10,13-14,18-19H,11-12,15-17H2,1-8H3;2*1-2H3 |
| InChIKey | OLASLUZAPKEGAU-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.76 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|