C23H30O2 — CID 163971025
2-methyl-3-[(E)-3,7,8-trimethylnon-2-enyl]naphthalene-1,4-dione (PubChem CID 163971025) has the molecular formula C23H30O2 and a molecular weight of 338.49 g/mol. Its IUPAC name is 2-methyl-3-[(E)-3,7,8-trimethylnon-2-enyl]naphthalene-1,4-dione.
| Compound Name | 2-methyl-3-[(E)-3,7,8-trimethylnon-2-enyl]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 163971025 |
| Molecular Formula | C23H30O2 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | 2-methyl-3-[(E)-3,7,8-trimethylnon-2-enyl]naphthalene-1,4-dione |
| SMILES | CC1=C(C/C=C(\C)CCCC(C)C(C)C)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H30O2/c1-15(2)17(4)10-8-9-16(3)13-14-19-18(5)22(24)20-11-6-7-12-21(20)23(19)25/h6-7,11-13,15,17H,8-10,14H2,1-5H3/b16-13+ |
| InChIKey | SPZQGWFLMDIYEZ-DTQAZKPQSA-N |
| XLogP | 6.18 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|