C51H76O2 — CID 74413400
2-methyl-3-(3,7,11,15,19,23,27,31-octamethyldotriaconta-6,10,18,22,26,30-hexaenyl)naphthalene-1,4-dione (PubChem CID 74413400) has the molecular formula C51H76O2 and a molecular weight of 721.17 g/mol. Its IUPAC name is 2-methyl-3-(3,7,11,15,19,23,27,31-octamethyldotriaconta-6,10,18,22,26,30-hexaenyl)naphthalene-1,4-dione.
| Compound Name | 2-methyl-3-(3,7,11,15,19,23,27,31-octamethyldotriaconta-6,10,18,22,26,30-hexaenyl)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 74413400 |
| Molecular Formula | C51H76O2 |
| Molecular Weight | 721.17 g/mol |
| Exact Mass | 720.58 |
| IUPAC Name | 2-methyl-3-(3,7,11,15,19,23,27,31-octamethyldotriaconta-6,10,18,22,26,30-hexaenyl)naphthalene-1,4-dione |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)CCCC(C)=CCCC(C)=CCCC(C)CCC1=C(C)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C51H76O2/c1-38(2)20-13-21-39(3)22-14-23-40(4)24-15-25-41(5)26-16-27-42(6)28-17-29-43(7)30-18-31-44(8)32-19-33-45(9)36-37-47-46(10)50(52)48-34-11-12-35-49(48)51(47)53/h11-12,20,22,24,26,30,32,34-35,42,45H,13-19,21,23,25,27-29,31,33,36-37H2,1-10H3 |
| InChIKey | OPUAEJCZYCQMBM-UHFFFAOYSA-N |
| XLogP | 15.98 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.17 |
| LogP ≤ 5 | 15.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|