C25H26O2 — CID 155816692
2-[(3E)-4,8-dimethylnona-3,7-dienyl]anthracene-9,10-dione (PubChem CID 155816692) has the molecular formula C25H26O2 and a molecular weight of 358.48 g/mol. Its IUPAC name is 2-[(3E)-4,8-dimethylnona-3,7-dienyl]anthracene-9,10-dione.
| Compound Name | 2-[(3E)-4,8-dimethylnona-3,7-dienyl]anthracene-9,10-dione |
|---|---|
| PubChem CID | 155816692 |
| Molecular Formula | C25H26O2 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 2-[(3E)-4,8-dimethylnona-3,7-dienyl]anthracene-9,10-dione |
| SMILES | CC(C)=CCC/C(C)=C/CCc1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C25H26O2/c1-17(2)8-6-9-18(3)10-7-11-19-14-15-22-23(16-19)25(27)21-13-5-4-12-20(21)24(22)26/h4-5,8,10,12-16H,6-7,9,11H2,1-3H3/b18-10+ |
| InChIKey | YGNPHNOMVBPITA-VCHYOVAHSA-N |
| XLogP | 6.09 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|