C23H34 — CID 15545601
1-methyl-3-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]benzene (PubChem CID 15545601) has the molecular formula C23H34 and a molecular weight of 310.53 g/mol. Its IUPAC name is 1-methyl-3-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]benzene.
| Compound Name | 1-methyl-3-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]benzene |
|---|---|
| PubChem CID | 15545601 |
| Molecular Formula | C23H34 |
| Molecular Weight | 310.53 g/mol |
| Exact Mass | 310.27 |
| IUPAC Name | 1-methyl-3-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]benzene |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CCc1cccc(C)c1 |
| InChI | InChI=1S/C23H34/c1-19(2)10-6-11-20(3)12-7-13-21(4)14-8-16-23-17-9-15-22(5)18-23/h9-10,12,14-15,17-18H,6-8,11,13,16H2,1-5H3/b20-12+,21-14+ |
| InChIKey | MWKLPYLIXRGXIN-KDXVVQHGSA-N |
| XLogP | 7.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.53 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|