C23H34 — CID 135074710
1-propan-2-yl-3-[(3E,7E)-4,8,10-trimethylundeca-3,7,9-trienyl]benzene (PubChem CID 135074710) has the molecular formula C23H34 and a molecular weight of 310.53 g/mol. Its IUPAC name is 1-propan-2-yl-3-[(3E,7E)-4,8,10-trimethylundeca-3,7,9-trienyl]benzene.
| Compound Name | 1-propan-2-yl-3-[(3E,7E)-4,8,10-trimethylundeca-3,7,9-trienyl]benzene |
|---|---|
| PubChem CID | 135074710 |
| Molecular Formula | C23H34 |
| Molecular Weight | 310.53 g/mol |
| Exact Mass | 310.27 |
| IUPAC Name | 1-propan-2-yl-3-[(3E,7E)-4,8,10-trimethylundeca-3,7,9-trienyl]benzene |
| SMILES | CC(C)=C/C(C)=C/CC/C(C)=C/CCc1cccc(C(C)C)c1 |
| InChI | InChI=1S/C23H34/c1-18(2)16-21(6)12-7-10-20(5)11-8-13-22-14-9-15-23(17-22)19(3)4/h9,11-12,14-17,19H,7-8,10,13H2,1-6H3/b20-11+,21-12+ |
| InChIKey | TVCHYCROUMKWNW-HGEIODPWSA-N |
| XLogP | 7.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.53 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|