C36H44O2 — CID 71042452
2,6-bis[(3E)-4,8-dimethylnona-3,7-dienyl]anthracene-9,10-dione (PubChem CID 71042452) has the molecular formula C36H44O2 and a molecular weight of 508.75 g/mol. Its IUPAC name is 2,6-bis[(3E)-4,8-dimethylnona-3,7-dienyl]anthracene-9,10-dione.
| Compound Name | 2,6-bis[(3E)-4,8-dimethylnona-3,7-dienyl]anthracene-9,10-dione |
|---|---|
| PubChem CID | 71042452 |
| Molecular Formula | C36H44O2 |
| Molecular Weight | 508.75 g/mol |
| Exact Mass | 508.33 |
| IUPAC Name | 2,6-bis[(3E)-4,8-dimethylnona-3,7-dienyl]anthracene-9,10-dione |
| SMILES | CC(C)=CCC/C(C)=C/CCc1ccc2c(c1)C(=O)c1ccc(CC/C=C(\C)CCC=C(C)C)cc1C2=O |
| InChI | InChI=1S/C36H44O2/c1-25(2)11-7-13-27(5)15-9-17-29-19-21-31-33(23-29)35(37)32-22-20-30(24-34(32)36(31)38)18-10-16-28(6)14-8-12-26(3)4/h11-12,15-16,19-24H,7-10,13-14,17-18H2,1-6H3/b27-15+,28-16+ |
| InChIKey | QFJKNXROORXZBQ-DPCVLPDWSA-N |
| XLogP | 9.71 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.75 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|