C30H46S — CID 54588649
3-[(3E,7E,11E,15E)-4,8,12,16,20-pentamethylhenicosa-3,7,11,15,19-pentaenyl]thiophene (PubChem CID 54588649) has the molecular formula C30H46S and a molecular weight of 438.77 g/mol. Its IUPAC name is 3-[(3E,7E,11E,15E)-4,8,12,16,20-pentamethylhenicosa-3,7,11,15,19-pentaenyl]thiophene.
| Compound Name | 3-[(3E,7E,11E,15E)-4,8,12,16,20-pentamethylhenicosa-3,7,11,15,19-pentaenyl]thiophene |
|---|---|
| PubChem CID | 54588649 |
| Molecular Formula | C30H46S |
| Molecular Weight | 438.77 g/mol |
| Exact Mass | 438.33 |
| IUPAC Name | 3-[(3E,7E,11E,15E)-4,8,12,16,20-pentamethylhenicosa-3,7,11,15,19-pentaenyl]thiophene |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CCc1ccsc1 |
| InChI | InChI=1S/C30H46S/c1-25(2)12-7-13-26(3)14-8-15-27(4)16-9-17-28(5)18-10-19-29(6)20-11-21-30-22-23-31-24-30/h12,14,16,18,20,22-24H,7-11,13,15,17,19,21H2,1-6H3/b26-14+,27-16+,28-18+,29-20+ |
| InChIKey | MHMWGMNOUGVLJM-ZURUDOERSA-N |
| XLogP | 10.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.77 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|