C26H40S — CID 89431402
3-[(3E,7E,11E)-4-ethyl-8,12,16-trimethylheptadeca-3,7,11,15-tetraenyl]thiophene (PubChem CID 89431402) has the molecular formula C26H40S and a molecular weight of 384.67 g/mol. Its IUPAC name is 3-[(3E,7E,11E)-4-ethyl-8,12,16-trimethylheptadeca-3,7,11,15-tetraenyl]thiophene.
| Compound Name | 3-[(3E,7E,11E)-4-ethyl-8,12,16-trimethylheptadeca-3,7,11,15-tetraenyl]thiophene |
|---|---|
| PubChem CID | 89431402 |
| Molecular Formula | C26H40S |
| Molecular Weight | 384.67 g/mol |
| Exact Mass | 384.29 |
| IUPAC Name | 3-[(3E,7E,11E)-4-ethyl-8,12,16-trimethylheptadeca-3,7,11,15-tetraenyl]thiophene |
| SMILES | CC/C(=C\CCc1ccsc1)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C26H40S/c1-6-25(17-10-18-26-19-20-27-21-26)16-9-15-24(5)14-8-13-23(4)12-7-11-22(2)3/h11,13,15,17,19-21H,6-10,12,14,16,18H2,1-5H3/b23-13+,24-15+,25-17+ |
| InChIKey | VQRGKSUWYPVYRW-HBKYZHKXSA-N |
| XLogP | 9.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.67 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|