C28H44S — CID 123768255
3-(4,8,12,16-tetramethylicosa-3,7,11,15-tetraenyl)thiophene (PubChem CID 123768255) has the molecular formula C28H44S and a molecular weight of 412.73 g/mol. Its IUPAC name is 3-(4,8,12,16-tetramethylicosa-3,7,11,15-tetraenyl)thiophene.
| Compound Name | 3-(4,8,12,16-tetramethylicosa-3,7,11,15-tetraenyl)thiophene |
|---|---|
| PubChem CID | 123768255 |
| Molecular Formula | C28H44S |
| Molecular Weight | 412.73 g/mol |
| Exact Mass | 412.32 |
| IUPAC Name | 3-(4,8,12,16-tetramethylicosa-3,7,11,15-tetraenyl)thiophene |
| SMILES | CCCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCc1ccsc1 |
| InChI | InChI=1S/C28H44S/c1-6-7-12-24(2)13-8-14-25(3)15-9-16-26(4)17-10-18-27(5)19-11-20-28-21-22-29-23-28/h13,15,17,19,21-23H,6-12,14,16,18,20H2,1-5H3 |
| InChIKey | RLIXRMNTJCZMJD-UHFFFAOYSA-N |
| XLogP | 10.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.73 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|